About N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine
N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine (PubChem CID 11791862) has the molecular formula C21H19FN4
and a molecular weight of 346.41 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine |
| PubChem CID | 11791862 |
| Molecular Formula | C21H19FN4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine |
| SMILES | Fc1cccc(-n2cc3c(n2)c(NC2CCCC2)nc2ccccc23)c1 |
| InChI | InChI=1S/C21H19FN4/c22-14-6-5-9-16(12-14)26-13-18-17-10-3-4-11-19(17)24-21(20(18)25-26)23-15-7-1-2-8-15/h3-6,9-13,15H,1-2,7-8H2,(H,23,24) |
| InChIKey | UPWBBBQTTVWBOF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine?
The IUPAC name of N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine (CID 11791862) is N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine.
What is the SMILES notation for N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine?
The canonical SMILES for N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine is Fc1cccc(-n2cc3c(n2)c(NC2CCCC2)nc2ccccc23)c1.
What is the InChIKey of N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine?
The InChIKey is UPWBBBQTTVWBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN4/c22-14-6-5-9-16(12-14)26-13-18-17-10-3-4-11-19(17)24-21(20(18)25-26)23-15-7-1-2-8-15/h3-6,9-13,15H,1-2,7-8H2,(H,23,24).
What are the key properties of N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine?
N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine has a molecular weight of 346.41 g/mol, XLogP of 5.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(3-fluorophenyl)pyrazolo[3,4-c]quinolin-4-amine is sourced from PubChem (CID 11791862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).