About (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide
(E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide (PubChem CID 11791985) has the molecular formula C19H19Cl2NO
and a molecular weight of 348.27 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide |
| PubChem CID | 11791985 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)NCCCCc1ccccc1 |
| InChI | InChI=1S/C19H19Cl2NO/c20-17-10-11-18(21)16(14-17)9-12-19(23)22-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,14H,4-5,8,13H2,(H,22,23)/b12-9+ |
| InChIKey | JQXFFCNMKLAXDC-FMIVXFBMSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide?
The IUPAC name of (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide (CID 11791985) is (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide.
What is the SMILES notation for (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide?
The canonical SMILES for (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide is O=C(/C=C/c1cc(Cl)ccc1Cl)NCCCCc1ccccc1.
What is the InChIKey of (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide?
The InChIKey is JQXFFCNMKLAXDC-FMIVXFBMSA-N. The full InChI is InChI=1S/C19H19Cl2NO/c20-17-10-11-18(21)16(14-17)9-12-19(23)22-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,14H,4-5,8,13H2,(H,22,23)/b12-9+.
What are the key properties of (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide?
(E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide has a molecular weight of 348.27 g/mol, XLogP of 5.15, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,5-dichlorophenyl)-N-(4-phenylbutyl)prop-2-enamide is sourced from PubChem (CID 11791985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).