About benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate
benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate (PubChem CID 11792025) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate |
| PubChem CID | 11792025 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate |
| SMILES | CC(C)(CO)CNC(=O)N1CCCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O4/c1-19(2,14-22)13-20-18(24)21-11-7-6-10-16(21)17(23)25-12-15-8-4-3-5-9-15/h3-5,8-9,16,22H,6-7,10-14H2,1-2H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | GEYGKLXGCKUOLL-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate?
The IUPAC name of benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate (CID 11792025) is benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate.
What is the SMILES notation for benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate?
The canonical SMILES for benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate is CC(C)(CO)CNC(=O)N1CCCC[C@H]1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate?
The InChIKey is GEYGKLXGCKUOLL-INIZCTEOSA-N. The full InChI is InChI=1S/C19H28N2O4/c1-19(2,14-22)13-20-18(24)21-11-7-6-10-16(21)17(23)25-12-15-8-4-3-5-9-15/h3-5,8-9,16,22H,6-7,10-14H2,1-2H3,(H,20,24)/t16-/m0/s1.
What are the key properties of benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate?
benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate has a molecular weight of 348.44 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-1-[(3-hydroxy-2,2-dimethylpropyl)carbamoyl]piperidine-2-carboxylate is sourced from PubChem (CID 11792025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).