C25H22N2 — CID 11792168
5-benzyl-1,3-diphenyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrrole (PubChem CID 11792168) has the molecular formula C25H22N2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 5-benzyl-1,3-diphenyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-benzyl-1,3-diphenyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 11792168 |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 5-benzyl-1,3-diphenyl-4,6-dihydro-2H-pyrrolo[3,4-c]pyrrole |
| SMILES | c1ccc(CN2Cc3c(-c4ccccc4)[nH]c(-c4ccccc4)c3C2)cc1 |
| InChI | InChI=1S/C25H22N2/c1-4-10-19(11-5-1)16-27-17-22-23(18-27)25(21-14-8-3-9-15-21)26-24(22)20-12-6-2-7-13-20/h1-15,26H,16-18H2 |
| InChIKey | XPZIIJVAVYDHEE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |