C20H22O2Si2 — CID 11792193
3,4-bis[dimethyl(phenyl)silyl]cyclobut-3-ene-1,2-dione (PubChem CID 11792193) has the molecular formula C20H22O2Si2 and a molecular weight of 350.57 g/mol. Its IUPAC name is 3,4-bis[dimethyl(phenyl)silyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[dimethyl(phenyl)silyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11792193 |
| Molecular Formula | C20H22O2Si2 |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3,4-bis[dimethyl(phenyl)silyl]cyclobut-3-ene-1,2-dione |
| SMILES | C[Si](C)(c1ccccc1)c1c([Si](C)(C)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C20H22O2Si2/c1-23(2,15-11-7-5-8-12-15)19-17(21)18(22)20(19)24(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | ODGZVKZOXDFQEM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|