C18H15N3O3S — CID 11792363
5-[[2-[(4-aminophenyl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 11792363) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-[[2-[(4-aminophenyl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(4-aminophenyl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11792363 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-[[2-[(4-aminophenyl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Nc1ccc(Cc2nc3cc(CC4SC(=O)NC4=O)ccc3o2)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c19-12-4-1-10(2-5-12)9-16-20-13-7-11(3-6-14(13)24-16)8-15-17(22)21-18(23)25-15/h1-7,15H,8-9,19H2,(H,21,22,23) |
| InChIKey | ACLUHVAZYGYBDK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|