C20H24N2O4 — CID 11792584
2-[(2R,4aS,6R,8aS)-2-(2-hydroxyphenyl)-3,7-dimethyl-2,4,4a,6,8,8a-hexahydro-[1,3]oxazino[6,5-e][1,3]oxazin-6-yl]phenol (PubChem CID 11792584) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[(2R,4aS,6R,8aS)-2-(2-hydroxyphenyl)-3,7-dimethyl-2,4,4a,6,8,8a-hexahydro-[1,3]oxazino[6,5-e][1,3]oxazin-6-yl]phenol.
| Compound Name | 2-[(2R,4aS,6R,8aS)-2-(2-hydroxyphenyl)-3,7-dimethyl-2,4,4a,6,8,8a-hexahydro-[1,3]oxazino[6,5-e][1,3]oxazin-6-yl]phenol |
|---|---|
| PubChem CID | 11792584 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[(2R,4aS,6R,8aS)-2-(2-hydroxyphenyl)-3,7-dimethyl-2,4,4a,6,8,8a-hexahydro-[1,3]oxazino[6,5-e][1,3]oxazin-6-yl]phenol |
| SMILES | CN1C[C@@H]2O[C@H](c3ccccc3O)N(C)C[C@@H]2O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C20H24N2O4/c1-21-11-17-18(25-19(21)13-7-3-5-9-15(13)23)12-22(2)20(26-17)14-8-4-6-10-16(14)24/h3-10,17-20,23-24H,11-12H2,1-2H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | MYBXABGEBLTPDJ-VNTMZGSJSA-N |
| XLogP | 2.46 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|