C20H32O4Si — CID 11793173
(1R,5S,7S,8R,10R)-8-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-10-prop-2-enyl-3,11-dioxatricyclo[5.3.1.01,5]undecan-9-one (PubChem CID 11793173) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is (1R,5S,7S,8R,10R)-8-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-10-prop-2-enyl-3,11-dioxatricyclo[5.3.1.01,5]undecan-9-one.
| Compound Name | (1R,5S,7S,8R,10R)-8-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-10-prop-2-enyl-3,11-dioxatricyclo[5.3.1.01,5]undecan-9-one |
|---|---|
| PubChem CID | 11793173 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (1R,5S,7S,8R,10R)-8-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-10-prop-2-enyl-3,11-dioxatricyclo[5.3.1.01,5]undecan-9-one |
| SMILES | C=CC[C@H]1C(=O)[C@](C=C)(O[Si](C)(C)C(C)(C)C)[C@@H]2C[C@H]3COC[C@@]31O2 |
| InChI | InChI=1S/C20H32O4Si/c1-8-10-15-17(21)19(9-2,24-25(6,7)18(3,4)5)16-11-14-12-22-13-20(14,15)23-16/h8-9,14-16H,1-2,10-13H2,3-7H3/t14-,15-,16-,19+,20+/m0/s1 |
| InChIKey | HZSKHUUTUSWVRZ-WKKSIBQESA-N |
| XLogP | 3.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|