About 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride
6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride (PubChem CID 11793186) has the molecular formula C18H19ClF2N4
and a molecular weight of 364.83 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride |
| PubChem CID | 11793186 |
| Molecular Formula | C18H19ClF2N4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride |
| SMILES | Cc1nc2c(c(N3CCCCC3)n1)[NH2+]C(c1cc(F)cc(F)c1)=C2.[Cl-] |
| InChI | InChI=1S/C18H18F2N4.ClH/c1-11-21-16-10-15(12-7-13(19)9-14(20)8-12)23-17(16)18(22-11)24-5-3-2-4-6-24;/h7-10,23H,2-6H2,1H3;1H |
| InChIKey | ZNKQPVGMAIFAQQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 45.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride?
The IUPAC name of 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride (CID 11793186) is 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride.
What is the SMILES notation for 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride?
The canonical SMILES for 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride is Cc1nc2c(c(N3CCCCC3)n1)[NH2+]C(c1cc(F)cc(F)c1)=C2.[Cl-].
What is the InChIKey of 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride?
The InChIKey is ZNKQPVGMAIFAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N4.ClH/c1-11-21-16-10-15(12-7-13(19)9-14(20)8-12)23-17(16)18(22-11)24-5-3-2-4-6-24;/h7-10,23H,2-6H2,1H3;1H.
What are the key properties of 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride?
6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride has a molecular weight of 364.83 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-5-ium chloride is sourced from PubChem (CID 11793186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).