About 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline
7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline (PubChem CID 11793675) has the molecular formula C26H32N2
and a molecular weight of 372.56 g/mol. Its IUPAC name is 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline |
| PubChem CID | 11793675 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline |
| SMILES | CCCCC1=C(c2ccc(C(C)(C)C)cc2)N2CCCN=C2c2ccccc21 |
| InChI | InChI=1S/C26H32N2/c1-5-6-10-22-21-11-7-8-12-23(21)25-27-17-9-18-28(25)24(22)19-13-15-20(16-14-19)26(2,3)4/h7-8,11-16H,5-6,9-10,17-18H2,1-4H3 |
| InChIKey | VNBPNFZLNMXVOP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline?
The IUPAC name of 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline (CID 11793675) is 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline.
What is the SMILES notation for 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline?
The canonical SMILES for 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline is CCCCC1=C(c2ccc(C(C)(C)C)cc2)N2CCCN=C2c2ccccc21.
What is the InChIKey of 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline?
The InChIKey is VNBPNFZLNMXVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2/c1-5-6-10-22-21-11-7-8-12-23(21)25-27-17-9-18-28(25)24(22)19-13-15-20(16-14-19)26(2,3)4/h7-8,11-16H,5-6,9-10,17-18H2,1-4H3.
What are the key properties of 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline?
7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline has a molecular weight of 372.56 g/mol, XLogP of 6.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline is sourced from PubChem (CID 11793675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).