About (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol
(3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol (PubChem CID 11793692) has the molecular formula C19H13ClO4S
and a molecular weight of 372.83 g/mol. Its IUPAC name is (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol.
Molecular Properties
| Compound Name | (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol |
| PubChem CID | 11793692 |
| Molecular Formula | C19H13ClO4S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol |
| SMILES | O=S1(=O)c2ccccc2Oc2cccc(C(O)c3cccc(Cl)c3)c21 |
| InChI | InChI=1S/C19H13ClO4S/c20-13-6-3-5-12(11-13)18(21)14-7-4-9-16-19(14)25(22,23)17-10-2-1-8-15(17)24-16/h1-11,18,21H |
| InChIKey | KVXZWSIVLALKMM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol?
The IUPAC name of (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol (CID 11793692) is (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol.
What is the SMILES notation for (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol?
The canonical SMILES for (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol is O=S1(=O)c2ccccc2Oc2cccc(C(O)c3cccc(Cl)c3)c21.
What is the InChIKey of (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol?
The InChIKey is KVXZWSIVLALKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClO4S/c20-13-6-3-5-12(11-13)18(21)14-7-4-9-16-19(14)25(22,23)17-10-2-1-8-15(17)24-16/h1-11,18,21H.
What are the key properties of (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol?
(3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol has a molecular weight of 372.83 g/mol, XLogP of 4.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-(10,10-dioxophenoxathiin-1-yl)methanol is sourced from PubChem (CID 11793692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).