C17H31NO6Si — CID 11793755
1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 11793755) has the molecular formula C17H31NO6Si and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11793755 |
| Molecular Formula | C17H31NO6Si |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO6Si/c1-16(2,3)23-15(21)18-11(14(20)22-7)10-12(13(18)19)24-25(8,9)17(4,5)6/h11-12H,10H2,1-9H3/t11-,12+/m0/s1 |
| InChIKey | HGHGHRORRVDFRJ-NWDGAFQWSA-N |
| XLogP | 3.09 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|