C21H35NO3Si — CID 11794006
methyl 5-[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-cyano-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 11794006) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is methyl 5-[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-cyano-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-cyano-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 11794006 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | methyl 5-[(3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-cyano-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=C[C@H]2[C@@H](C1)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C#N |
| InChI | InChI=1S/C21H35NO3Si/c1-21(2,3)26(5,6)25-19-13-16-11-15(12-17(16)18(19)14-22)9-7-8-10-20(23)24-4/h12,16-19H,7-11,13H2,1-6H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | QYMZISNEBSUGRM-INDMIFKZSA-N |
| XLogP | 5.22 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|