About tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate
tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate (PubChem CID 11794098) has the molecular formula C19H25NO7
and a molecular weight of 379.41 g/mol. Its IUPAC name is tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate |
| PubChem CID | 11794098 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate |
| SMILES | CC(C)(C)OC(=O)ON(C(=O)CC(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25NO7/c1-18(2,3)25-16(23)20(27-17(24)26-19(4,5)6)15(22)12-14(21)13-10-8-7-9-11-13/h7-11H,12H2,1-6H3 |
| InChIKey | DFACPMGJPROMMU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate?
The IUPAC name of tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate (CID 11794098) is tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate.
What is the SMILES notation for tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate?
The canonical SMILES for tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate is CC(C)(C)OC(=O)ON(C(=O)CC(=O)c1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate?
The InChIKey is DFACPMGJPROMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO7/c1-18(2,3)25-16(23)20(27-17(24)26-19(4,5)6)15(22)12-14(21)13-10-8-7-9-11-13/h7-11H,12H2,1-6H3.
What are the key properties of tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate?
tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate has a molecular weight of 379.41 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-(3-oxo-3-phenylpropanoyl)amino] carbonate is sourced from PubChem (CID 11794098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).