C16H28O10 — CID 11794150
(2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol (PubChem CID 11794150) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11794150 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(2-methylbut-3-en-2-yloxy)oxane-3,4,5-triol |
| SMILES | C=CC(C)(C)O[C@@H]1O[C@H](CO[C@@H]2OC[C@](O)(CO)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H28O10/c1-4-15(2,3)26-13-11(20)10(19)9(18)8(25-13)5-23-14-12(21)16(22,6-17)7-24-14/h4,8-14,17-22H,1,5-7H2,2-3H3/t8-,9-,10+,11-,12+,13+,14-,16-/m1/s1 |
| InChIKey | BUKBJIBZOCTYLQ-UQTFRHSQSA-N |
| XLogP | -2.77 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|