C22H36O5 — CID 11794189
[(1R,4R,5E,8R,9E,11S)-4,8-dihydroxy-1,4,8-trimethyl-2-oxo-11-propan-2-ylcyclotrideca-5,9-dien-1-yl]methyl acetate (PubChem CID 11794189) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(1R,4R,5E,8R,9E,11S)-4,8-dihydroxy-1,4,8-trimethyl-2-oxo-11-propan-2-ylcyclotrideca-5,9-dien-1-yl]methyl acetate.
| Compound Name | [(1R,4R,5E,8R,9E,11S)-4,8-dihydroxy-1,4,8-trimethyl-2-oxo-11-propan-2-ylcyclotrideca-5,9-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11794189 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(1R,4R,5E,8R,9E,11S)-4,8-dihydroxy-1,4,8-trimethyl-2-oxo-11-propan-2-ylcyclotrideca-5,9-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CC[C@@H](C(C)C)/C=C/[C@](C)(O)C/C=C/[C@](C)(O)CC1=O |
| InChI | InChI=1S/C22H36O5/c1-16(2)18-8-12-20(4,15-27-17(3)23)19(24)14-22(6,26)11-7-10-21(5,25)13-9-18/h7,9,11,13,16,18,25-26H,8,10,12,14-15H2,1-6H3/b11-7+,13-9+/t18-,20-,21-,22+/m1/s1 |
| InChIKey | MOTBGHLVUHHVFC-DCURBPOESA-N |
| XLogP | 3.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|