C18H15N5O5 — CID 11794206
8,9-dimethoxy-6-(3-nitrophenyl)-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one (PubChem CID 11794206) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 8,9-dimethoxy-6-(3-nitrophenyl)-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one.
| Compound Name | 8,9-dimethoxy-6-(3-nitrophenyl)-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one |
|---|---|
| PubChem CID | 11794206 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 8,9-dimethoxy-6-(3-nitrophenyl)-2,11-dihydro-[1,2,4]triazolo[4,3-c][2,3]benzodiazepin-3-one |
| SMILES | COc1cc2c(cc1OC)C(c1cccc([N+](=O)[O-])c1)=Nn1c(n[nH]c1=O)C2 |
| InChI | InChI=1S/C18H15N5O5/c1-27-14-7-11-8-16-19-20-18(24)22(16)21-17(13(11)9-15(14)28-2)10-4-3-5-12(6-10)23(25)26/h3-7,9H,8H2,1-2H3,(H,20,24) |
| InChIKey | PLRBYKVLIWSBMJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|