C37H40F3N7O5 — CID 117942849
(S)-2-benzyl 3-ethyl 8-(2-amino-6-((R)-2,2,2-trifluoro-1-(2-(3-methyl-1H-pyrazol-1-yl)-4-vinylphenyl)ethoxy)pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2,3-dicarboxylate (PubChem CID 117942849) has the molecular formula C37H40F3N7O5 and a molecular weight of 719.80 g/mol. Its IUPAC name is 2-O-benzyl 3-O-ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-ethenyl-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2,3-dicarboxylate.
| Compound Name | (S)-2-benzyl 3-ethyl 8-(2-amino-6-((R)-2,2,2-trifluoro-1-(2-(3-methyl-1H-pyrazol-1-yl)-4-vinylphenyl)ethoxy)pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 117942849 |
| Molecular Formula | C37H40F3N7O5 |
| Molecular Weight | 719.80 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | 2-O-benzyl 3-O-ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-ethenyl-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2(CCN(CC2)C3=CC(=NC(=N3)N)O[C@H](C4=C(C=C(C=C4)C=C)N5C=CC(=N5)C)C(F)(F)F)CN1C(=O)OCC6=CC=CC=C6 |
| InChI | InChI=1S/C37H40F3N7O5/c1-4-25-11-12-27(28(19-25)47-16-13-24(3)44-47)32(37(38,39)40)52-31-20-30(42-34(41)43-31)45-17-14-36(15-18-45)21-29(33(48)50-5-2)46(23-36)35(49)51-22-26-9-7-6-8-10-26/h4,6-13,16,19-20,29,32H,1,5,14-15,17-18,21-23H2,2-3H3,(H2,41,42,43)/t29-,32+/m0/s1 |
| InChIKey | JLVNHCZDIHMNAR-BHDXBOSCSA-N |
| XLogP | 6.90 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | 1220 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.80 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |