C13H21Br2NO2 — CID 11794333
tert-butyl 2-(3,3-dibromoprop-2-enyl)piperidine-1-carboxylate (PubChem CID 11794333) has the molecular formula C13H21Br2NO2 and a molecular weight of 383.12 g/mol. Its IUPAC name is tert-butyl 2-(3,3-dibromoprop-2-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3,3-dibromoprop-2-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11794333 |
| Molecular Formula | C13H21Br2NO2 |
| Molecular Weight | 383.12 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | tert-butyl 2-(3,3-dibromoprop-2-enyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CC=C(Br)Br |
| InChI | InChI=1S/C13H21Br2NO2/c1-13(2,3)18-12(17)16-9-5-4-6-10(16)7-8-11(14)15/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | FMJJSKSAFCLDEI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.12 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |