C23H22F3N3O2 — CID 1179437
4-[4-(4-methylpiperidin-1-yl)anilino]-8-(trifluoromethyl)quinoline-3-carboxylic acid (PubChem CID 1179437) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-[4-(4-methylpiperidin-1-yl)anilino]-8-(trifluoromethyl)quinoline-3-carboxylic acid.
| Compound Name | 4-[4-(4-methylpiperidin-1-yl)anilino]-8-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 1179437 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[4-(4-methylpiperidin-1-yl)anilino]-8-(trifluoromethyl)quinoline-3-carboxylic acid |
| SMILES | CC1CCN(c2ccc(Nc3c(C(=O)O)cnc4c(C(F)(F)F)cccc34)cc2)CC1 |
| InChI | InChI=1S/C23H22F3N3O2/c1-14-9-11-29(12-10-14)16-7-5-15(6-8-16)28-20-17-3-2-4-19(23(24,25)26)21(17)27-13-18(20)22(30)31/h2-8,13-14H,9-12H2,1H3,(H,27,28)(H,30,31) |
| InChIKey | SZVSXDMZDKCFHK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|