About 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine
4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine (PubChem CID 11794607) has the molecular formula C26H29NO2
and a molecular weight of 387.52 g/mol. Its IUPAC name is 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine |
| PubChem CID | 11794607 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine |
| SMILES | C/C=C(/C1=C(OCC)C=C(c2ccccc2)C1N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-3-22(20-11-7-5-8-12-20)25-24(29-4-2)19-23(21-13-9-6-10-14-21)26(25)27-15-17-28-18-16-27/h3,5-14,19,26H,4,15-18H2,1-2H3/b22-3+ |
| InChIKey | CVIYDXKQJCKJDF-HEQWTUPCSA-N |
| XLogP | 5.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine?
The IUPAC name of 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine (CID 11794607) is 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine.
What is the SMILES notation for 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine?
The canonical SMILES for 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine is C/C=C(/C1=C(OCC)C=C(c2ccccc2)C1N1CCOCC1)c1ccccc1.
What is the InChIKey of 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine?
The InChIKey is CVIYDXKQJCKJDF-HEQWTUPCSA-N. The full InChI is InChI=1S/C26H29NO2/c1-3-22(20-11-7-5-8-12-20)25-24(29-4-2)19-23(21-13-9-6-10-14-21)26(25)27-15-17-28-18-16-27/h3,5-14,19,26H,4,15-18H2,1-2H3/b22-3+.
What are the key properties of 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine?
4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine has a molecular weight of 387.52 g/mol, XLogP of 5.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-ethoxy-5-phenyl-2-[(E)-1-phenylprop-1-enyl]cyclopenta-2,4-dien-1-yl]morpholine is sourced from PubChem (CID 11794607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).