C19H36N2O6 — CID 11794655
(4R,5R)-4-N,5-N-bis[(2S)-1-hydroxy-4-methylpentan-2-yl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 11794655) has the molecular formula C19H36N2O6 and a molecular weight of 388.51 g/mol. Its IUPAC name is (4R,5R)-4-N,5-N-bis[(2S)-1-hydroxy-4-methylpentan-2-yl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-4-N,5-N-bis[(2S)-1-hydroxy-4-methylpentan-2-yl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 11794655 |
| Molecular Formula | C19H36N2O6 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4R,5R)-4-N,5-N-bis[(2S)-1-hydroxy-4-methylpentan-2-yl]-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)[C@@H]1OC(C)(C)O[C@H]1C(=O)N[C@H](CO)CC(C)C |
| InChI | InChI=1S/C19H36N2O6/c1-11(2)7-13(9-22)20-17(24)15-16(27-19(5,6)26-15)18(25)21-14(10-23)8-12(3)4/h11-16,22-23H,7-10H2,1-6H3,(H,20,24)(H,21,25)/t13-,14-,15+,16+/m0/s1 |
| InChIKey | WRRPIGKNFRPRCD-CAOSSQGBSA-N |
| XLogP | 0.55 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |