About 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate
3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate (PubChem CID 11794796) has the molecular formula C21H29NO6
and a molecular weight of 391.46 g/mol. Its IUPAC name is 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate |
| PubChem CID | 11794796 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)OC)C[C@H]1c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C21H29NO6/c1-4-27-20(23)17-13-22(21(24)26-3)12-16(17)14-9-10-18(25-2)19(11-14)28-15-7-5-6-8-15/h9-11,15-17H,4-8,12-13H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | UVJMVEXVQZBBHX-DLBZAZTESA-N |
| XLogP | 3.36 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The IUPAC name of 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate (CID 11794796) is 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The canonical SMILES for 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate is CCOC(=O)[C@@H]1CN(C(=O)OC)C[C@H]1c1ccc(OC)c(OC2CCCC2)c1.
What is the InChIKey of 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The InChIKey is UVJMVEXVQZBBHX-DLBZAZTESA-N. The full InChI is InChI=1S/C21H29NO6/c1-4-27-20(23)17-13-22(21(24)26-3)12-16(17)14-9-10-18(25-2)19(11-14)28-15-7-5-6-8-15/h9-11,15-17H,4-8,12-13H2,1-3H3/t16-,17+/m0/s1.
What are the key properties of 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate has a molecular weight of 391.46 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 1-O-methyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate is sourced from PubChem (CID 11794796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).