C13H19N2O8PS — CID 11794926
methyl 2-[[2-(dimethoxyphosphorylmethylamino)-2-oxoethyl]sulfamoyl]benzoate (PubChem CID 11794926) has the molecular formula C13H19N2O8PS and a molecular weight of 394.34 g/mol. Its IUPAC name is methyl 2-[[2-(dimethoxyphosphorylmethylamino)-2-oxoethyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-[[2-(dimethoxyphosphorylmethylamino)-2-oxoethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 11794926 |
| Molecular Formula | C13H19N2O8PS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | methyl 2-[[2-(dimethoxyphosphorylmethylamino)-2-oxoethyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NCC(=O)NCP(=O)(OC)OC |
| InChI | InChI=1S/C13H19N2O8PS/c1-21-13(17)10-6-4-5-7-11(10)25(19,20)15-8-12(16)14-9-24(18,22-2)23-3/h4-7,15H,8-9H2,1-3H3,(H,14,16) |
| InChIKey | STEURVPQDKVQDH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|