C13H20F6O3Si2 — CID 11794939
1,1,1,3,3,3-hexafluoropropan-2-yl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate (PubChem CID 11794939) has the molecular formula C13H20F6O3Si2 and a molecular weight of 394.46 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate |
|---|---|
| PubChem CID | 11794939 |
| Molecular Formula | C13H20F6O3Si2 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-oxo-2,3-bis(trimethylsilyl)but-3-enoate |
| SMILES | C[Si](C)(C)C(=C=O)C(C(=O)OC(C(F)(F)F)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C13H20F6O3Si2/c1-23(2,3)8(7-20)9(24(4,5)6)10(21)22-11(12(14,15)16)13(17,18)19/h9,11H,1-6H3 |
| InChIKey | SXFJFKSPBDOIDE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|