C22H25N3O4 — CID 11794997
2-oxo-1-[[3-(propan-2-ylcarbamoylamino)phenyl]methyl]-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid (PubChem CID 11794997) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-oxo-1-[[3-(propan-2-ylcarbamoylamino)phenyl]methyl]-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid.
| Compound Name | 2-oxo-1-[[3-(propan-2-ylcarbamoylamino)phenyl]methyl]-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 11794997 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-oxo-1-[[3-(propan-2-ylcarbamoylamino)phenyl]methyl]-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid |
| SMILES | CC(C)NC(=O)Nc1cccc(CN2C(=O)C(C(=O)O)CCc3ccccc32)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-14(2)23-22(29)24-17-8-5-6-15(12-17)13-25-19-9-4-3-7-16(19)10-11-18(20(25)26)21(27)28/h3-9,12,14,18H,10-11,13H2,1-2H3,(H,27,28)(H2,23,24,29) |
| InChIKey | UCUMUFWYFWFQBQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|