About tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate
tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate (PubChem CID 11795418) has the molecular formula C15H26Cl3NO3Si
and a molecular weight of 402.82 g/mol. Its IUPAC name is tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate |
| PubChem CID | 11795418 |
| Molecular Formula | C15H26Cl3NO3Si |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate |
| SMILES | CC/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)C |
| InChI | InChI=1S/C15H26Cl3NO3Si/c1-8-9-11(23(5,6)7)10-19(12(20)15(16,17)18)13(21)22-14(2,3)4/h9H,8,10H2,1-7H3/b11-9- |
| InChIKey | ZOTYYPWFYIXRQS-LUAWRHEFSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate?
The IUPAC name of tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate (CID 11795418) is tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate.
What is the SMILES notation for tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate?
The canonical SMILES for tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate is CC/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)C.
What is the InChIKey of tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate?
The InChIKey is ZOTYYPWFYIXRQS-LUAWRHEFSA-N. The full InChI is InChI=1S/C15H26Cl3NO3Si/c1-8-9-11(23(5,6)7)10-19(12(20)15(16,17)18)13(21)22-14(2,3)4/h9H,8,10H2,1-7H3/b11-9-.
What are the key properties of tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate?
tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate has a molecular weight of 402.82 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate is sourced from PubChem (CID 11795418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).