C15H26Cl3NO3Si — CID 11795418
tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate (PubChem CID 11795418) has the molecular formula C15H26Cl3NO3Si and a molecular weight of 402.82 g/mol. Its IUPAC name is tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate.
| Compound Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate |
|---|---|
| PubChem CID | 11795418 |
| Molecular Formula | C15H26Cl3NO3Si |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylpent-2-enyl]carbamate |
| SMILES | CC/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)C |
| InChI | InChI=1S/C15H26Cl3NO3Si/c1-8-9-11(23(5,6)7)10-19(12(20)15(16,17)18)13(21)22-14(2,3)4/h9H,8,10H2,1-7H3/b11-9- |
| InChIKey | ZOTYYPWFYIXRQS-LUAWRHEFSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|