C28H25N3 — CID 11795470
(4S,5S)-N-benzhydryl-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 11795470) has the molecular formula C28H25N3 and a molecular weight of 403.53 g/mol. Its IUPAC name is (4S,5S)-N-benzhydryl-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | (4S,5S)-N-benzhydryl-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 11795470 |
| Molecular Formula | C28H25N3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4S,5S)-N-benzhydryl-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | c1ccc(C(NC2=N[C@@H](c3ccccc3)[C@H](c3ccccc3)N2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)29-28-30-26(23-17-9-3-10-18-23)27(31-28)24-19-11-4-12-20-24/h1-20,25-27H,(H2,29,30,31)/t26-,27-/m0/s1 |
| InChIKey | PXLTXOFSLFDTNZ-SVBPBHIXSA-N |
| XLogP | 5.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |