C22H32O5Si — CID 11795537
2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]oxy-6-hydroxyphenyl]benzene-1,3-diol (PubChem CID 11795537) has the molecular formula C22H32O5Si and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]oxy-6-hydroxyphenyl]benzene-1,3-diol.
| Compound Name | 2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]oxy-6-hydroxyphenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 11795537 |
| Molecular Formula | C22H32O5Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]oxy-6-hydroxyphenyl]benzene-1,3-diol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)Oc1cccc(O)c1-c1c(O)cccc1O |
| InChI | InChI=1S/C22H32O5Si/c1-14(15(2)27-28(6,7)22(3,4)5)26-19-13-9-12-18(25)21(19)20-16(23)10-8-11-17(20)24/h8-15,23-25H,1-7H3/t14-,15+/m1/s1 |
| InChIKey | RJMLAWBGRPPHCS-CABCVRRESA-N |
| XLogP | 5.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|