C19H40O5Si2 — CID 11795546
(5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxypropyl]oxolan-2-one (PubChem CID 11795546) has the molecular formula C19H40O5Si2 and a molecular weight of 404.70 g/mol. Its IUPAC name is (5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxypropyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxypropyl]oxolan-2-one |
|---|---|
| PubChem CID | 11795546 |
| Molecular Formula | C19H40O5Si2 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxypropyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]([C@H]1CCC(=O)O1)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O5Si2/c1-18(2,3)25(7,8)23-15(13-20)17(14-11-12-16(21)22-14)24-26(9,10)19(4,5)6/h14-15,17,20H,11-13H2,1-10H3/t14-,15-,17+/m1/s1 |
| InChIKey | LUQMZMCPCXMFFE-INMHGKMJSA-N |
| XLogP | 4.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|