C28H24O3 — CID 11795729
methyl (1S,4S,6S)-4-methyl-7-oxo-2,3,6-triphenylbicyclo[2.2.1]hept-2-ene-1-carboxylate (PubChem CID 11795729) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl (1S,4S,6S)-4-methyl-7-oxo-2,3,6-triphenylbicyclo[2.2.1]hept-2-ene-1-carboxylate.
| Compound Name | methyl (1S,4S,6S)-4-methyl-7-oxo-2,3,6-triphenylbicyclo[2.2.1]hept-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11795729 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | methyl (1S,4S,6S)-4-methyl-7-oxo-2,3,6-triphenylbicyclo[2.2.1]hept-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)[C@@](C)(C[C@H]1c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C28H24O3/c1-27-18-22(19-12-6-3-7-13-19)28(25(27)29,26(30)31-2)24(21-16-10-5-11-17-21)23(27)20-14-8-4-9-15-20/h3-17,22H,18H2,1-2H3/t22-,27-,28-/m0/s1 |
| InChIKey | AGORGYKAKCLXJP-FAQZDJIUSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|