C26H40N2O2 — CID 11795964
(2S,5S)-5-(hydroxymethyl)-1,1',1'-trimethyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,4'-cyclohexane]-3-one (PubChem CID 11795964) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (2S,5S)-5-(hydroxymethyl)-1,1',1'-trimethyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,4'-cyclohexane]-3-one.
| Compound Name | (2S,5S)-5-(hydroxymethyl)-1,1',1'-trimethyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,4'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 11795964 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | (2S,5S)-5-(hydroxymethyl)-1,1',1'-trimethyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,4'-cyclohexane]-3-one |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](CO)Cc2cc3c(cc2N1C)C1(CCC3)CCC(C)(C)CC1 |
| InChI | InChI=1S/C26H40N2O2/c1-17(2)23-24(30)27-20(16-29)14-19-13-18-7-6-8-26(11-9-25(3,4)10-12-26)21(18)15-22(19)28(23)5/h13,15,17,20,23,29H,6-12,14,16H2,1-5H3,(H,27,30)/t20-,23-/m0/s1 |
| InChIKey | JZQRNYZBAVMSEE-REWPJTCUSA-N |
| XLogP | 4.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |