C19H22N6O5 — CID 11796049
N-[4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl]acetamide (PubChem CID 11796049) has the molecular formula C19H22N6O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11796049 |
| Molecular Formula | C19H22N6O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[4-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H22N6O5/c1-10(27)24-12-4-2-11(3-5-12)6-20-17-14-18(22-8-21-17)25(9-23-14)19-16(29)15(28)13(7-26)30-19/h2-5,8-9,13,15-16,19,26,28-29H,6-7H2,1H3,(H,24,27)(H,20,21,22)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | DWSHEQWQWSPIEF-NVQRDWNXSA-N |
| XLogP | 0.01 |
| TPSA | 154.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |