C22H24F2N2O4 — CID 11796267
ethyl 2-[[tert-butyl-(4-fluorobenzoyl)amino]-(4-fluorobenzoyl)amino]acetate (PubChem CID 11796267) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl-(4-fluorobenzoyl)amino]-(4-fluorobenzoyl)amino]acetate.
| Compound Name | ethyl 2-[[tert-butyl-(4-fluorobenzoyl)amino]-(4-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 11796267 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 2-[[tert-butyl-(4-fluorobenzoyl)amino]-(4-fluorobenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccc(F)cc1)N(C(=O)c1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C22H24F2N2O4/c1-5-30-19(27)14-25(20(28)15-6-10-17(23)11-7-15)26(22(2,3)4)21(29)16-8-12-18(24)13-9-16/h6-13H,5,14H2,1-4H3 |
| InChIKey | DMDJFWZXESHCQY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|