C21H34N2O3Si2 — CID 11796311
(4S)-3-[(3S)-1-[bis(trimethylsilyl)methyl]-2,2-dimethyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11796311) has the molecular formula C21H34N2O3Si2 and a molecular weight of 418.69 g/mol. Its IUPAC name is (4S)-3-[(3S)-1-[bis(trimethylsilyl)methyl]-2,2-dimethyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3S)-1-[bis(trimethylsilyl)methyl]-2,2-dimethyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11796311 |
| Molecular Formula | C21H34N2O3Si2 |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (4S)-3-[(3S)-1-[bis(trimethylsilyl)methyl]-2,2-dimethyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)[C@H](N2C(=O)OC[C@@H]2c2ccccc2)C(=O)N1C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H34N2O3Si2/c1-21(2)17(18(24)23(21)20(27(3,4)5)28(6,7)8)22-16(14-26-19(22)25)15-12-10-9-11-13-15/h9-13,16-17,20H,14H2,1-8H3/t16-,17-/m1/s1 |
| InChIKey | ZLMWGHFABFNMSH-IAGOWNOFSA-N |
| XLogP | 4.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|