C24H33N7 — CID 11796354
2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(1R)-1-phenylethyl]purine-2,6-diamine (PubChem CID 11796354) has the molecular formula C24H33N7 and a molecular weight of 419.58 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(1R)-1-phenylethyl]purine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(1R)-1-phenylethyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 11796354 |
| Molecular Formula | C24H33N7 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(1R)-1-phenylethyl]purine-2,6-diamine |
| SMILES | C[C@@H](Nc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H33N7/c1-16(17-7-3-2-4-8-17)27-22-21-23(31(15-26-21)20-9-5-6-10-20)30-24(29-22)28-19-13-11-18(25)12-14-19/h2-4,7-8,15-16,18-20H,5-6,9-14,25H2,1H3,(H2,27,28,29,30)/t16-,18?,19?/m1/s1 |
| InChIKey | ICOAPDOBTUNNPQ-IPJUCJBFSA-N |
| XLogP | 4.80 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |