C9H7Cl6O4P — CID 11796518
2-chloroethyl methyl (2,3,4,5,6-pentachlorophenyl) phosphate (PubChem CID 11796518) has the molecular formula C9H7Cl6O4P and a molecular weight of 422.84 g/mol. Its IUPAC name is 2-chloroethyl methyl (2,3,4,5,6-pentachlorophenyl) phosphate.
| Compound Name | 2-chloroethyl methyl (2,3,4,5,6-pentachlorophenyl) phosphate |
|---|---|
| PubChem CID | 11796518 |
| Molecular Formula | C9H7Cl6O4P |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 419.82 |
| IUPAC Name | 2-chloroethyl methyl (2,3,4,5,6-pentachlorophenyl) phosphate |
| SMILES | COP(=O)(OCCCl)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl6O4P/c1-17-20(16,18-3-2-10)19-9-7(14)5(12)4(11)6(13)8(9)15/h2-3H2,1H3 |
| InChIKey | PFUYKMWMZUSWGE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|