About CID 11796606
CID 11796606 (PubChem CID 11796606) has the molecular formula C24H40O6
and a molecular weight of 424.58 g/mol.
Molecular Properties
| Compound Name | CID 11796606 |
| PubChem CID | 11796606 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C[C@@H](OC(C)=O)[C@H]2C(C)(C)CCC[C@@]23C)[C@H](OC)O1 |
| InChI | InChI=1S/C24H40O6/c1-15-13-17(28-16(2)25)19-21(3,4)9-8-10-22(19,5)24(15)12-11-23(30-24)14-18(26-6)29-20(23)27-7/h15,17-20H,8-14H2,1-7H3/t15-,17-,18-,19+,20-,22+,23+,24-/m1/s1 |
| InChIKey | YCGYYZXBHVNOIX-VBKRYCECSA-N |
| XLogP | 4.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 11796606 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11796606?
The IUPAC name of CID 11796606 (CID 11796606) is not available.
What is the SMILES notation for CID 11796606?
The canonical SMILES for CID 11796606 is CO[C@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C[C@@H](OC(C)=O)[C@H]2C(C)(C)CCC[C@@]23C)[C@H](OC)O1.
What is the InChIKey of CID 11796606?
The InChIKey is YCGYYZXBHVNOIX-VBKRYCECSA-N. The full InChI is InChI=1S/C24H40O6/c1-15-13-17(28-16(2)25)19-21(3,4)9-8-10-22(19,5)24(15)12-11-23(30-24)14-18(26-6)29-20(23)27-7/h15,17-20H,8-14H2,1-7H3/t15-,17-,18-,19+,20-,22+,23+,24-/m1/s1.
What are the key properties of CID 11796606?
CID 11796606 has a molecular weight of 424.58 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11796606 is sourced from PubChem (CID 11796606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).