About ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate
ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate (PubChem CID 1179668) has the molecular formula C22H21NO6
and a molecular weight of 395.41 g/mol. Its IUPAC name is ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 1179668 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2c(C)oc3c2C(=O)c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C22H21NO6/c1-3-28-22(27)13-8-10-23(11-9-13)21(26)16-12(2)29-20-17(16)18(24)14-6-4-5-7-15(14)19(20)25/h4-7,13H,3,8-11H2,1-2H3 |
| InChIKey | YCQRDSJRASINSW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate (CID 1179668) is ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2c(C)oc3c2C(=O)c2ccccc2C3=O)CC1.
What is the InChIKey of ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate?
The InChIKey is YCQRDSJRASINSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO6/c1-3-28-22(27)13-8-10-23(11-9-13)21(26)16-12(2)29-20-17(16)18(24)14-6-4-5-7-15(14)19(20)25/h4-7,13H,3,8-11H2,1-2H3.
What are the key properties of ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate?
ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate has a molecular weight of 395.41 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 1179668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).