C27H32N4O — CID 11796805
4-[(Z)-[(3Z)-3-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylidene]-2-oxocycloheptylidene]methyl]-N,N-dimethylbenzenecarboximidamide (PubChem CID 11796805) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[(Z)-[(3Z)-3-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylidene]-2-oxocycloheptylidene]methyl]-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 4-[(Z)-[(3Z)-3-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylidene]-2-oxocycloheptylidene]methyl]-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 11796805 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 4-[(Z)-[(3Z)-3-[[4-(N,N-dimethylcarbamimidoyl)phenyl]methylidene]-2-oxocycloheptylidene]methyl]-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(/C=C2/CCCC/C(=C/c3ccc(/C(=N\[H])N(C)C)cc3)C2=O)cc1)N(C)C |
| InChI | InChI=1S/C27H32N4O/c1-30(2)26(28)21-13-9-19(10-14-21)17-23-7-5-6-8-24(25(23)32)18-20-11-15-22(16-12-20)27(29)31(3)4/h9-18,28-29H,5-8H2,1-4H3/b23-17-,24-18-,28-26-,29-27+ |
| InChIKey | ACQPTINNLFSDRI-SNKPSPIGSA-N |
| XLogP | 5.07 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|