C23H30NO3PS — CID 11796946
tert-butyl (4S)-4-(diphenylphosphinothioylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11796946) has the molecular formula C23H30NO3PS and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl (4S)-4-(diphenylphosphinothioylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(diphenylphosphinothioylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11796946 |
| Molecular Formula | C23H30NO3PS |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | tert-butyl (4S)-4-(diphenylphosphinothioylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CP(=S)(c2ccccc2)c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C23H30NO3PS/c1-22(2,3)27-21(25)24-18(16-26-23(24,4)5)17-28(29,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18H,16-17H2,1-5H3/t18-/m0/s1 |
| InChIKey | KJDJMNRKQWZKPH-SFHVURJKSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|