C26H24O6 — CID 11796972
5-methoxy-7-methyl-2-(1,5,8-trimethoxy-3-methylnaphthalen-2-yl)naphthalene-1,4-dione (PubChem CID 11796972) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is 5-methoxy-7-methyl-2-(1,5,8-trimethoxy-3-methylnaphthalen-2-yl)naphthalene-1,4-dione.
| Compound Name | 5-methoxy-7-methyl-2-(1,5,8-trimethoxy-3-methylnaphthalen-2-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 11796972 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-methoxy-7-methyl-2-(1,5,8-trimethoxy-3-methylnaphthalen-2-yl)naphthalene-1,4-dione |
| SMILES | COc1cc(C)cc2c1C(=O)C=C(c1c(C)cc3c(OC)ccc(OC)c3c1OC)C2=O |
| InChI | InChI=1S/C26H24O6/c1-13-9-16-23(21(10-13)31-5)18(27)12-17(25(16)28)22-14(2)11-15-19(29-3)7-8-20(30-4)24(15)26(22)32-6/h7-12H,1-6H3 |
| InChIKey | YUNVZEWFMYFZAA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|