C24H29N5OS — CID 11797166
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,3-dihydro-1H-indole-7-carboxamide (PubChem CID 11797166) has the molecular formula C24H29N5OS and a molecular weight of 435.60 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,3-dihydro-1H-indole-7-carboxamide.
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,3-dihydro-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 11797166 |
| Molecular Formula | C24H29N5OS |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,3-dihydro-1H-indole-7-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1cccc2c1NCC2 |
| InChI | InChI=1S/C24H29N5OS/c30-24(20-8-5-6-18-10-12-25-22(18)20)26-11-3-4-13-28-14-16-29(17-15-28)23-19-7-1-2-9-21(19)31-27-23/h1-2,5-9,25H,3-4,10-17H2,(H,26,30) |
| InChIKey | VIHHTBYBRANJQC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|