C22H19N2O4S2+ — CID 1179729
7-methyl-6-[2-methyl-3-(7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-6-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 1179729) has the molecular formula C22H19N2O4S2+ and a molecular weight of 439.54 g/mol. Its IUPAC name is 7-methyl-6-[2-methyl-3-(7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-6-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
| Compound Name | 7-methyl-6-[2-methyl-3-(7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-6-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 1179729 |
| Molecular Formula | C22H19N2O4S2+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 7-methyl-6-[2-methyl-3-(7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-7-ium-6-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | CC(=Cc1sc2cc3c(cc2[n+]1C)OCO3)C=C1Sc2cc3c(cc2N1C)OCO3 |
| InChI | InChI=1S/C22H19N2O4S2/c1-12(4-21-23(2)13-6-15-17(27-10-25-15)8-19(13)29-21)5-22-24(3)14-7-16-18(28-11-26-16)9-20(14)30-22/h4-9H,10-11H2,1-3H3/q+1 |
| InChIKey | PXYAITVPBPIRPB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|