C28H34N2OS — CID 11797651
1-cycloheptyl-1-[(5-phenylthiophen-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 11797651) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is 1-cycloheptyl-1-[(5-phenylthiophen-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-cycloheptyl-1-[(5-phenylthiophen-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 11797651 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-cycloheptyl-1-[(5-phenylthiophen-2-yl)methyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc(-c3ccccc3)s2)C2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C28H34N2OS/c1-20-17-21(2)27(22(3)18-20)29-28(31)30(24-13-9-4-5-10-14-24)19-25-15-16-26(32-25)23-11-7-6-8-12-23/h6-8,11-12,15-18,24H,4-5,9-10,13-14,19H2,1-3H3,(H,29,31) |
| InChIKey | UEYKLYKQEQKGJX-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |