C21H28N4O5S — CID 11797718
N-tert-butyl-2-cyclopropyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]acetamide (PubChem CID 11797718) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-tert-butyl-2-cyclopropyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-cyclopropyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 11797718 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-tert-butyl-2-cyclopropyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)C(C1CC1)N1C(=O)[C@H](CS)NC(=O)[C@@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H28N4O5S/c1-21(2,3)23-19(27)17(13-6-7-13)24-16(18(26)22-15(11-31)20(24)28)10-12-4-8-14(9-5-12)25(29)30/h4-5,8-9,13,15-17,31H,6-7,10-11H2,1-3H3,(H,22,26)(H,23,27)/t15-,16-,17?/m0/s1 |
| InChIKey | SRGKYQVDQPZBLM-PYNWJHIZSA-N |
| XLogP | 1.46 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|