C26H50O4Si — CID 11798010
(E,2S,3R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-ol (PubChem CID 11798010) has the molecular formula C26H50O4Si and a molecular weight of 454.77 g/mol. Its IUPAC name is (E,2S,3R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-ol.
| Compound Name | (E,2S,3R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-ol |
|---|---|
| PubChem CID | 11798010 |
| Molecular Formula | C26H50O4Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | (E,2S,3R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-ol |
| SMILES | COCOC(C)(C)/C=C/[C@@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H50O4Si/c1-19(22(27)15-17-25(5,6)29-18-28-8)20-13-14-21-23(12-11-16-26(20,21)7)30-31(9,10)24(2,3)4/h15,17,19-23,27H,11-14,16,18H2,1-10H3/b17-15+/t19-,20+,21-,22+,23-,26+/m0/s1 |
| InChIKey | GQBSWNUWGGOTJK-JNGNIKBNSA-N |
| XLogP | 6.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|