C20H25F3N4OS2 — CID 11798129
3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-4-one (PubChem CID 11798129) has the molecular formula C20H25F3N4OS2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11798129 |
| Molecular Formula | C20H25F3N4OS2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1C(CC(F)(F)F)SCN1CCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C20H25F3N4OS2/c21-20(22,23)13-17-19(28)27(14-29-17)8-4-3-7-25-9-11-26(12-10-25)18-15-5-1-2-6-16(15)30-24-18/h1-2,5-6,17H,3-4,7-14H2 |
| InChIKey | UCUYUQLHQLTCSM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|