C25H36N2O4S — CID 11798214
(2S)-2-cyclohexyl-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(phenylmethoxyamino)ethanone (PubChem CID 11798214) has the molecular formula C25H36N2O4S and a molecular weight of 460.64 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(phenylmethoxyamino)ethanone.
| Compound Name | (2S)-2-cyclohexyl-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(phenylmethoxyamino)ethanone |
|---|---|
| PubChem CID | 11798214 |
| Molecular Formula | C25H36N2O4S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (2S)-2-cyclohexyl-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(phenylmethoxyamino)ethanone |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)[C@@H](NOCc1ccccc1)C1CCCCC1)[C@H]3C2 |
| InChI | InChI=1S/C25H36N2O4S/c1-24(2)20-13-14-25(24)17-32(29,30)27(21(25)15-20)23(28)22(19-11-7-4-8-12-19)26-31-16-18-9-5-3-6-10-18/h3,5-6,9-10,19-22,26H,4,7-8,11-17H2,1-2H3/t20-,21-,22-,25-/m0/s1 |
| InChIKey | ASKQILDMCDDMFQ-UEOMBKFZSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|