About 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane
2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane (PubChem CID 11798355) has the molecular formula C23H28O6S2
and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane |
| PubChem CID | 11798355 |
| Molecular Formula | C23H28O6S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane |
| SMILES | C/C(=C\CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)COC1CCCCO1 |
| InChI | InChI=1S/C23H28O6S2/c1-19(18-29-22-14-8-9-17-28-22)15-16-23(30(24,25)20-10-4-2-5-11-20)31(26,27)21-12-6-3-7-13-21/h2-7,10-13,15,22-23H,8-9,14,16-18H2,1H3/b19-15+ |
| InChIKey | CRARJZBIKRGALZ-XDJHFCHBSA-N |
| XLogP | 4.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane?
The IUPAC name of 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane (CID 11798355) is 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane.
What is the SMILES notation for 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane?
The canonical SMILES for 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane is C/C(=C\CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)COC1CCCCO1.
What is the InChIKey of 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane?
The InChIKey is CRARJZBIKRGALZ-XDJHFCHBSA-N. The full InChI is InChI=1S/C23H28O6S2/c1-19(18-29-22-14-8-9-17-28-22)15-16-23(30(24,25)20-10-4-2-5-11-20)31(26,27)21-12-6-3-7-13-21/h2-7,10-13,15,22-23H,8-9,14,16-18H2,1H3/b19-15+.
What are the key properties of 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane?
2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane has a molecular weight of 464.61 g/mol, XLogP of 4.14, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-5,5-bis(benzenesulfonyl)-2-methylpent-2-enoxy]oxane is sourced from PubChem (CID 11798355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).